C7H3F9O — CID 175690130
3,3,4,4-tetrafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)but-1-ene (PubChem CID 175690130) has the molecular formula C7H3F9O and a molecular weight of 274.08 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)but-1-ene.
| Compound Name | 3,3,4,4-tetrafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)but-1-ene |
|---|---|
| PubChem CID | 175690130 |
| Molecular Formula | C7H3F9O |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3,3,4,4-tetrafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)but-1-ene |
| SMILES | C=CC(F)(F)C(F)(F)OC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C7H3F9O/c1-2-5(11,12)7(15,16)17-6(13,14)3(8)4(9)10/h2H,1H2 |
| InChIKey | HKKAQLFMWOBYAP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|