About 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine
1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine (PubChem CID 175690487) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine |
| PubChem CID | 175690487 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine |
| SMILES | C1=CCN(C2CC=CN2)C=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-7-11(8-3-1)9-5-4-6-10-9/h1-4,6-7,9-10H,5,8H2 |
| InChIKey | QJVBLDKBCPFHBK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine?
The IUPAC name of 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine (CID 175690487) is 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine.
What is the SMILES notation for 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine?
The canonical SMILES for 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine is C1=CCN(C2CC=CN2)C=C1.
What is the InChIKey of 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine?
The InChIKey is QJVBLDKBCPFHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-2-7-11(8-3-1)9-5-4-6-10-9/h1-4,6-7,9-10H,5,8H2.
What are the key properties of 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine?
1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-pyrrol-2-yl)-2H-pyridine is sourced from PubChem (CID 175690487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).