About 3-(trideuteriomethyl)-1,2,4-thiadiazole
3-(trideuteriomethyl)-1,2,4-thiadiazole (PubChem CID 175691094) has the molecular formula C3H4N2S
and a molecular weight of 103.16 g/mol. Its IUPAC name is 3-(trideuteriomethyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-(trideuteriomethyl)-1,2,4-thiadiazole |
| PubChem CID | 175691094 |
| Molecular Formula | C3H4N2S |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.03 |
| IUPAC Name | 3-(trideuteriomethyl)-1,2,4-thiadiazole |
| SMILES | [2H]C([2H])([2H])c1ncsn1 |
| InChI | InChI=1S/C3H4N2S/c1-3-4-2-6-5-3/h2H,1H3/i1D3 |
| InChIKey | IBANRDPEOYZVGW-FIBGUPNXSA-N |
| XLogP | 0.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(trideuteriomethyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trideuteriomethyl)-1,2,4-thiadiazole?
The IUPAC name of 3-(trideuteriomethyl)-1,2,4-thiadiazole (CID 175691094) is 3-(trideuteriomethyl)-1,2,4-thiadiazole.
What is the SMILES notation for 3-(trideuteriomethyl)-1,2,4-thiadiazole?
The canonical SMILES for 3-(trideuteriomethyl)-1,2,4-thiadiazole is [2H]C([2H])([2H])c1ncsn1.
What is the InChIKey of 3-(trideuteriomethyl)-1,2,4-thiadiazole?
The InChIKey is IBANRDPEOYZVGW-FIBGUPNXSA-N. The full InChI is InChI=1S/C3H4N2S/c1-3-4-2-6-5-3/h2H,1H3/i1D3.
What are the key properties of 3-(trideuteriomethyl)-1,2,4-thiadiazole?
3-(trideuteriomethyl)-1,2,4-thiadiazole has a molecular weight of 103.16 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trideuteriomethyl)-1,2,4-thiadiazole is sourced from PubChem (CID 175691094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).