About 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole
2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole (PubChem CID 175691571) has the molecular formula C8H5N5O
and a molecular weight of 187.16 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole.
Analyze 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole?
The IUPAC name of 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole (CID 175691571) is 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole.
What is the SMILES notation for 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole?
The canonical SMILES for 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole is c1cc2nc(-c3ncco3)nn2cn1.
What is the InChIKey of 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole?
The InChIKey is BXSILPFXBOMZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5O/c1-2-9-5-13-6(1)11-7(12-13)8-10-3-4-14-8/h1-5H.
What are the key properties of 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole?
2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole has a molecular weight of 187.16 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[1,5-c]pyrimidin-2-yl)-1,3-oxazole is sourced from PubChem (CID 175691571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).