C12H14F3N3O5S — CID 175692239
ethyl 2-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrrolo[2,1-e]pyrazole-4,3'-azetidine]-1'-carboxylate (PubChem CID 175692239) has the molecular formula C12H14F3N3O5S and a molecular weight of 369.32 g/mol. Its IUPAC name is ethyl 2-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrrolo[2,1-e]pyrazole-4,3'-azetidine]-1'-carboxylate.
| Compound Name | ethyl 2-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrrolo[2,1-e]pyrazole-4,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 175692239 |
| Molecular Formula | C12H14F3N3O5S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | ethyl 2-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrrolo[2,1-e]pyrazole-4,3'-azetidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CC2(CCn3nc(OS(=O)(=O)C(F)(F)F)cc32)C1 |
| InChI | InChI=1S/C12H14F3N3O5S/c1-2-22-10(19)17-6-11(7-17)3-4-18-8(11)5-9(16-18)23-24(20,21)12(13,14)15/h5H,2-4,6-7H2,1H3 |
| InChIKey | DUEOOVMGFIIGID-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|