C32H35BClF4N7NaO4S — CID 175692570
CID 175692570 (PubChem CID 175692570) has the molecular formula C32H35BClF4N7NaO4S and a molecular weight of 758.99 g/mol.
| Compound Name | CID 175692570 |
|---|---|
| PubChem CID | 175692570 |
| Molecular Formula | C32H35BClF4N7NaO4S |
| Molecular Weight | 758.99 g/mol |
| Exact Mass | 758.21 |
| IUPAC Name | — |
| SMILES | COCCNC1CCC(c2cnc(N)c3c(-c4cc(F)c(NS(=O)(=O)c5cc(OC(F)F)ccc5Cl)cc4F)nn(C(C)C)c23)CC1.[B-]C#N.[Na+] |
| InChI | InChI=1S/C31H35ClF4N6O4S.CBN.Na/c1-16(2)42-29-21(17-4-6-18(7-5-17)38-10-11-45-3)15-39-30(37)27(29)28(40-42)20-13-24(34)25(14-23(20)33)41-47(43,44)26-12-19(46-31(35)36)8-9-22(26)32;2-1-3;/h8-9,12-18,31,38,41H,4-7,10-11H2,1-3H3,(H2,37,39);;/q;-1;+1 |
| InChIKey | RJRKQOSDYWDVTJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.99 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|