About 2H-benzo[h]chromen-5-ol
2H-benzo[h]chromen-5-ol (PubChem CID 175692788) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2H-benzo[h]chromen-5-ol.
Molecular Properties
| Compound Name | 2H-benzo[h]chromen-5-ol |
| PubChem CID | 175692788 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2H-benzo[h]chromen-5-ol |
| SMILES | Oc1cc2ccccc2c2c1C=CCO2 |
| InChI | InChI=1S/C13H10O2/c14-12-8-9-4-1-2-5-10(9)13-11(12)6-3-7-15-13/h1-6,8,14H,7H2 |
| InChIKey | OYOOBXXTEGBQAC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-benzo[h]chromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzo[h]chromen-5-ol?
The IUPAC name of 2H-benzo[h]chromen-5-ol (CID 175692788) is 2H-benzo[h]chromen-5-ol.
What is the SMILES notation for 2H-benzo[h]chromen-5-ol?
The canonical SMILES for 2H-benzo[h]chromen-5-ol is Oc1cc2ccccc2c2c1C=CCO2.
What is the InChIKey of 2H-benzo[h]chromen-5-ol?
The InChIKey is OYOOBXXTEGBQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-12-8-9-4-1-2-5-10(9)13-11(12)6-3-7-15-13/h1-6,8,14H,7H2.
What are the key properties of 2H-benzo[h]chromen-5-ol?
2H-benzo[h]chromen-5-ol has a molecular weight of 198.22 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzo[h]chromen-5-ol is sourced from PubChem (CID 175692788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).