C14H21NO — CID 175693134
N,N-dimethyl-8-(3-methylbutyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine (PubChem CID 175693134) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N,N-dimethyl-8-(3-methylbutyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine.
| Compound Name | N,N-dimethyl-8-(3-methylbutyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
|---|---|
| PubChem CID | 175693134 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N,N-dimethyl-8-(3-methylbutyl)-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
| SMILES | CC(C)CCC1Oc2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C14H21NO/c1-10(2)5-7-13-12-9-11(15(3)4)6-8-14(12)16-13/h6,8-10,13H,5,7H2,1-4H3 |
| InChIKey | MZXYNMDTXVHMHK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|