About methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate
methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 175693436) has the molecular formula C15H17Cl2FN2O2
and a molecular weight of 347.22 g/mol. Its IUPAC name is methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate |
| PubChem CID | 175693436 |
| Molecular Formula | C15H17Cl2FN2O2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(CC2)C1Nc1cc(Cl)nc(Cl)c1F |
| InChI | InChI=1S/C15H17Cl2FN2O2/c1-22-15(21)11-7-2-4-8(5-3-7)13(11)19-9-6-10(16)20-14(17)12(9)18/h6-8,11,13H,2-5H2,1H3,(H,19,20) |
| InChIKey | KTOIRTRWHLYOOL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate?
The IUPAC name of methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate (CID 175693436) is methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate.
What is the SMILES notation for methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate?
The canonical SMILES for methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate is COC(=O)C1C2CCC(CC2)C1Nc1cc(Cl)nc(Cl)c1F.
What is the InChIKey of methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate?
The InChIKey is KTOIRTRWHLYOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2FN2O2/c1-22-15(21)11-7-2-4-8(5-3-7)13(11)19-9-6-10(16)20-14(17)12(9)18/h6-8,11,13H,2-5H2,1H3,(H,19,20).
What are the key properties of methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate?
methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate has a molecular weight of 347.22 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,6-dichloro-3-fluoro-4-pyridinyl)amino]bicyclo[2.2.2]octane-2-carboxylate is sourced from PubChem (CID 175693436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).