C13H18N6O3 — CID 175693565
2-amino-6-(cyclopropylamino)-9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-3H-purin-6-ol (PubChem CID 175693565) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-amino-6-(cyclopropylamino)-9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-3H-purin-6-ol.
| Compound Name | 2-amino-6-(cyclopropylamino)-9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-3H-purin-6-ol |
|---|---|
| PubChem CID | 175693565 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-amino-6-(cyclopropylamino)-9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-3H-purin-6-ol |
| SMILES | NC1=NC(O)(NC2CC2)c2ncn([C@H]3C=C[C@@H](CO)O3)c2N1 |
| InChI | InChI=1S/C13H18N6O3/c14-12-16-11-10(13(21,18-12)17-7-1-2-7)15-6-19(11)9-4-3-8(5-20)22-9/h3-4,6-9,17,20-21H,1-2,5H2,(H3,14,16,18)/t8-,9+,13?/m0/s1 |
| InChIKey | FVTQTFOVSZJSEA-GIKRIXFASA-N |
| XLogP | -1.08 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|