About 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate
4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate (PubChem CID 175693776) has the molecular formula C20H28O8
and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate.
Molecular Properties
| Compound Name | 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate |
| PubChem CID | 175693776 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate |
| SMILES | C=C(C)C(=O)CC(O)CC(=C)C(=O)O.C=CC(=O)OCC(O)CC(=O)C(=C)C |
| InChI | InChI=1S/2C10H14O4/c1-6(2)9(12)5-8(11)4-7(3)10(13)14;1-4-10(13)14-6-8(11)5-9(12)7(2)3/h8,11H,1,3-5H2,2H3,(H,13,14);4,8,11H,1-2,5-6H2,3H3 |
| InChIKey | ZJUPPPFQWXMAHG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate?
The IUPAC name of 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate (CID 175693776) is 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate.
What is the SMILES notation for 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate?
The canonical SMILES for 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate is C=C(C)C(=O)CC(O)CC(=C)C(=O)O.C=CC(=O)OCC(O)CC(=O)C(=C)C.
What is the InChIKey of 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate?
The InChIKey is ZJUPPPFQWXMAHG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O4/c1-6(2)9(12)5-8(11)4-7(3)10(13)14;1-4-10(13)14-6-8(11)5-9(12)7(2)3/h8,11H,1,3-5H2,2H3,(H,13,14);4,8,11H,1-2,5-6H2,3H3.
What are the key properties of 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate?
4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate has a molecular weight of 396.44 g/mol, XLogP of 1.53, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-7-methyl-2-methylidene-6-oxooct-7-enoic acid;(2-hydroxy-5-methyl-4-oxohex-5-enyl) prop-2-enoate is sourced from PubChem (CID 175693776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).