C18H23N2O5P — CID 175693785
(3R,3aS,6aS)-3-diethoxyphosphoryl-5-ethyl-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 175693785) has the molecular formula C18H23N2O5P and a molecular weight of 378.37 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-diethoxyphosphoryl-5-ethyl-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-3-diethoxyphosphoryl-5-ethyl-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 175693785 |
| Molecular Formula | C18H23N2O5P |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (3R,3aS,6aS)-3-diethoxyphosphoryl-5-ethyl-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCOP(=O)(OCC)[C@]1(c2ccccc2)N=C[C@H]2C(=O)N(CC)C(=O)[C@H]21 |
| InChI | InChI=1S/C18H23N2O5P/c1-4-20-16(21)14-12-19-18(15(14)17(20)22,13-10-8-7-9-11-13)26(23,24-5-2)25-6-3/h7-12,14-15H,4-6H2,1-3H3/t14-,15+,18+/m1/s1 |
| InChIKey | JJIRPDIZJVWLJK-VKJFTORMSA-N |
| XLogP | 2.81 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|