C9H9N3O2 — CID 175694110
3-[(1-methylpyrazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 175694110) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-methylpyrazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 175694110 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 3-[(1-methylpyrazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cn1ccc(CNc2cc(=O)c2=O)n1 |
| InChI | InChI=1S/C9H9N3O2/c1-12-3-2-6(11-12)5-10-7-4-8(13)9(7)14/h2-4,10H,5H2,1H3 |
| InChIKey | QLAQQALSCVSHDF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|