About 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine
3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine (PubChem CID 175696139) has the molecular formula C20H16N4
and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine.
Molecular Properties
| Compound Name | 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine |
| PubChem CID | 175696139 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine |
| SMILES | Cc1nnc(-c2cncnc2)cc1[C@H]1C[C@@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C20H16N4/c1-14-18(10-20(24-23-14)17-11-21-13-22-12-17)19-9-16(19)8-7-15-5-3-2-4-6-15/h2-6,10-13,16,19H,9H2,1H3/t16-,19-/m0/s1 |
| InChIKey | VLAUIFXYDUXMNU-LPHOPBHVSA-N |
| XLogP | 3.40 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine?
The IUPAC name of 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine (CID 175696139) is 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine.
What is the SMILES notation for 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine?
The canonical SMILES for 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine is Cc1nnc(-c2cncnc2)cc1[C@H]1C[C@@H]1C#Cc1ccccc1.
What is the InChIKey of 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine?
The InChIKey is VLAUIFXYDUXMNU-LPHOPBHVSA-N. The full InChI is InChI=1S/C20H16N4/c1-14-18(10-20(24-23-14)17-11-21-13-22-12-17)19-9-16(19)8-7-15-5-3-2-4-6-15/h2-6,10-13,16,19H,9H2,1H3/t16-,19-/m0/s1.
What are the key properties of 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine?
3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine has a molecular weight of 312.38 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(1S,2S)-2-(2-phenylethynyl)cyclopropyl]-6-pyrimidin-5-ylpyridazine is sourced from PubChem (CID 175696139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).