C11H16ClN3 — CID 175696147
2-(4-chloro-2-methylbutan-2-yl)-3H-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 175696147) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-(4-chloro-2-methylbutan-2-yl)-3H-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 2-(4-chloro-2-methylbutan-2-yl)-3H-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 175696147 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(4-chloro-2-methylbutan-2-yl)-3H-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)(CCCl)N1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C11H16ClN3/c1-11(2,6-7-12)15-9-14-8-4-3-5-10(14)13-15/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | IGNZXLCLNLHRJW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|