About 2,3-dihydropyrido[2,3-f]oxazepine
2,3-dihydropyrido[2,3-f]oxazepine (PubChem CID 175696969) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,3-dihydropyrido[2,3-f]oxazepine.
Molecular Properties
| Compound Name | 2,3-dihydropyrido[2,3-f]oxazepine |
| PubChem CID | 175696969 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2,3-dihydropyrido[2,3-f]oxazepine |
| SMILES | C1=Cc2ncccc2ONC1 |
| InChI | InChI=1S/C8H8N2O/c1-3-7-8(11-10-6-1)4-2-5-9-7/h1-5,10H,6H2 |
| InChIKey | OUWMFLXYAWRRGE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydropyrido[2,3-f]oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyrido[2,3-f]oxazepine?
The IUPAC name of 2,3-dihydropyrido[2,3-f]oxazepine (CID 175696969) is 2,3-dihydropyrido[2,3-f]oxazepine.
What is the SMILES notation for 2,3-dihydropyrido[2,3-f]oxazepine?
The canonical SMILES for 2,3-dihydropyrido[2,3-f]oxazepine is C1=Cc2ncccc2ONC1.
What is the InChIKey of 2,3-dihydropyrido[2,3-f]oxazepine?
The InChIKey is OUWMFLXYAWRRGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-3-7-8(11-10-6-1)4-2-5-9-7/h1-5,10H,6H2.
What are the key properties of 2,3-dihydropyrido[2,3-f]oxazepine?
2,3-dihydropyrido[2,3-f]oxazepine has a molecular weight of 148.16 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyrido[2,3-f]oxazepine is sourced from PubChem (CID 175696969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).