C23H20Cl2N8O7 — CID 175697461
butyl N-[2-[3,5-dichloro-4-[[6-oxo-5-[(6-oxo-1H-pyridazin-3-yl)methyl]-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate (PubChem CID 175697461) has the molecular formula C23H20Cl2N8O7 and a molecular weight of 591.37 g/mol. Its IUPAC name is butyl N-[2-[3,5-dichloro-4-[[6-oxo-5-[(6-oxo-1H-pyridazin-3-yl)methyl]-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate.
| Compound Name | butyl N-[2-[3,5-dichloro-4-[[6-oxo-5-[(6-oxo-1H-pyridazin-3-yl)methyl]-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate |
|---|---|
| PubChem CID | 175697461 |
| Molecular Formula | C23H20Cl2N8O7 |
| Molecular Weight | 591.37 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | butyl N-[2-[3,5-dichloro-4-[[6-oxo-5-[(6-oxo-1H-pyridazin-3-yl)methyl]-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazin-6-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nn(-c2cc(Cl)c(Oc3cc(Cc4ccc(=O)[nH]n4)c(=O)[nH]n3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H20Cl2N8O7/c1-2-3-6-39-23(38)26-19-21(36)27-22(37)33(32-19)13-9-14(24)18(15(25)10-13)40-17-8-11(20(35)31-30-17)7-12-4-5-16(34)29-28-12/h4-5,8-10H,2-3,6-7H2,1H3,(H,29,34)(H,31,35)(H,26,32,38)(H,27,36,37) |
| InChIKey | QCGYRIRVVWHDKQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 206.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|