C11H13IN2O — CID 175697772
3-iodo-5-methylspiro[3,4-dihydropyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane] (PubChem CID 175697772) has the molecular formula C11H13IN2O and a molecular weight of 316.14 g/mol. Its IUPAC name is 3-iodo-5-methylspiro[3,4-dihydropyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane].
| Compound Name | 3-iodo-5-methylspiro[3,4-dihydropyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane] |
|---|---|
| PubChem CID | 175697772 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-iodo-5-methylspiro[3,4-dihydropyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane] |
| SMILES | CN1CC(I)C2(CC2)Oc2cccnc21 |
| InChI | InChI=1S/C11H13IN2O/c1-14-7-9(12)11(4-5-11)15-8-3-2-6-13-10(8)14/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | OEXGCTOJAUETQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|