C9H10F3N3O2 — CID 175697887
2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 175697887) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 175697887 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | CCC(Nc1ncc(C(F)(F)F)cn1)C(=O)O |
| InChI | InChI=1S/C9H10F3N3O2/c1-2-6(7(16)17)15-8-13-3-5(4-14-8)9(10,11)12/h3-4,6H,2H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | RNYXBPBXACFUOF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |