C16H15ClN4O — CID 175697965
2-(4-chlorophenyl)-1,5,6,7,8,9-hexahydroazepino[1,2-a]purin-11-one (PubChem CID 175697965) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,5,6,7,8,9-hexahydroazepino[1,2-a]purin-11-one.
| Compound Name | 2-(4-chlorophenyl)-1,5,6,7,8,9-hexahydroazepino[1,2-a]purin-11-one |
|---|---|
| PubChem CID | 175697965 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(4-chlorophenyl)-1,5,6,7,8,9-hexahydroazepino[1,2-a]purin-11-one |
| SMILES | O=c1c2[nH]c(-c3ccc(Cl)cc3)nc2nc2n1CCCCC2 |
| InChI | InChI=1S/C16H15ClN4O/c17-11-7-5-10(6-8-11)14-19-13-15(20-14)18-12-4-2-1-3-9-21(12)16(13)22/h5-8H,1-4,9H2,(H,19,20) |
| InChIKey | DLAGIQMNAHVOPQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |