C21H18F9N5O4 — CID 175698595
2-[3-[5-amino-6-(5-methyl-1H-pyrazol-4-yl)pyrazin-2-yl]-4-(trideuteriomethyl)phenyl]-1,1,1,4,4,4-hexafluorobutane-2,3-diol;2,2,2-trifluoroacetic acid (PubChem CID 175698595) has the molecular formula C21H18F9N5O4 and a molecular weight of 578.41 g/mol. Its IUPAC name is 2-[3-[5-amino-6-(5-methyl-1H-pyrazol-4-yl)pyrazin-2-yl]-4-(trideuteriomethyl)phenyl]-1,1,1,4,4,4-hexafluorobutane-2,3-diol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[5-amino-6-(5-methyl-1H-pyrazol-4-yl)pyrazin-2-yl]-4-(trideuteriomethyl)phenyl]-1,1,1,4,4,4-hexafluorobutane-2,3-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175698595 |
| Molecular Formula | C21H18F9N5O4 |
| Molecular Weight | 578.41 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 2-[3-[5-amino-6-(5-methyl-1H-pyrazol-4-yl)pyrazin-2-yl]-4-(trideuteriomethyl)phenyl]-1,1,1,4,4,4-hexafluorobutane-2,3-diol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[2H]C([2H])([2H])c1ccc(C(O)(C(O)C(F)(F)F)C(F)(F)F)cc1-c1cnc(N)c(-c2cn[nH]c2C)n1 |
| InChI | InChI=1S/C19H17F6N5O2.C2HF3O2/c1-8-3-4-10(17(32,19(23,24)25)16(31)18(20,21)22)5-11(8)13-7-27-15(26)14(29-13)12-6-28-30-9(12)2;3-2(4,5)1(6)7/h3-7,16,31-32H,1-2H3,(H2,26,27)(H,28,30);(H,6,7)/i1D3; |
| InChIKey | FCEGUNQREUHQJR-NIIDSAIPSA-N |
| XLogP | 4.04 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |