About [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate
[2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate (PubChem CID 175698936) has the molecular formula C11H18F6N5OP
and a molecular weight of 381.26 g/mol. Its IUPAC name is [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate.
Molecular Properties
| Compound Name | [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate |
| PubChem CID | 175698936 |
| Molecular Formula | C11H18F6N5OP |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CN(C)C(ON1NNc2ccccc21)=[N+](C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C11H18N5O.F6P/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-7(2,3,4,5)6/h5-8,12-13H,1-4H3;/q+1;-1 |
| InChIKey | VJOUGTSOUUEFAR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate?
The IUPAC name of [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate (CID 175698936) is [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate.
What is the SMILES notation for [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate?
The canonical SMILES for [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate is CN(C)C(ON1NNc2ccccc21)=[N+](C)C.F[P-](F)(F)(F)(F)F.
What is the InChIKey of [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate?
The InChIKey is VJOUGTSOUUEFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N5O.F6P/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-7(2,3,4,5)6/h5-8,12-13H,1-4H3;/q+1;-1.
What are the key properties of [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate?
[2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate has a molecular weight of 381.26 g/mol, XLogP of 3.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydrobenzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate is sourced from PubChem (CID 175698936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).