C19H21FO5 — CID 175699296
(2R,3R,4R)-2-fluoro-4-hydroxy-3,5-bis(phenylmethoxy)pentanoic acid (PubChem CID 175699296) has the molecular formula C19H21FO5 and a molecular weight of 348.37 g/mol. Its IUPAC name is (2R,3R,4R)-2-fluoro-4-hydroxy-3,5-bis(phenylmethoxy)pentanoic acid.
| Compound Name | (2R,3R,4R)-2-fluoro-4-hydroxy-3,5-bis(phenylmethoxy)pentanoic acid |
|---|---|
| PubChem CID | 175699296 |
| Molecular Formula | C19H21FO5 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2R,3R,4R)-2-fluoro-4-hydroxy-3,5-bis(phenylmethoxy)pentanoic acid |
| SMILES | O=C(O)[C@H](F)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C19H21FO5/c20-17(19(22)23)18(25-12-15-9-5-2-6-10-15)16(21)13-24-11-14-7-3-1-4-8-14/h1-10,16-18,21H,11-13H2,(H,22,23)/t16-,17-,18-/m1/s1 |
| InChIKey | DTDCWJUTPFCCDV-KZNAEPCWSA-N |
| XLogP | 2.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |