C19H27N5O2 — CID 175699712
5-[[(2R)-1-tert-butylpyrrolidin-2-yl]methyl]-11-ethyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 175699712) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 5-[[(2R)-1-tert-butylpyrrolidin-2-yl]methyl]-11-ethyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 5-[[(2R)-1-tert-butylpyrrolidin-2-yl]methyl]-11-ethyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 175699712 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 5-[[(2R)-1-tert-butylpyrrolidin-2-yl]methyl]-11-ethyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CCc1cc2nc3c(c(=O)n2[nH]1)CN(C[C@H]1CCCN1C(C)(C)C)C3=O |
| InChI | InChI=1S/C19H27N5O2/c1-5-12-9-15-20-16-14(17(25)24(15)21-12)11-22(18(16)26)10-13-7-6-8-23(13)19(2,3)4/h9,13,21H,5-8,10-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | NWFRKGKJOCSCES-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |