C10H17NO3 — CID 175699802
2-ethyl-4-hydroxy-1-[(2S)-1-methoxypropan-2-yl]-2H-pyrrol-5-one (PubChem CID 175699802) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-1-[(2S)-1-methoxypropan-2-yl]-2H-pyrrol-5-one.
| Compound Name | 2-ethyl-4-hydroxy-1-[(2S)-1-methoxypropan-2-yl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 175699802 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-ethyl-4-hydroxy-1-[(2S)-1-methoxypropan-2-yl]-2H-pyrrol-5-one |
| SMILES | CCC1C=C(O)C(=O)N1[C@@H](C)COC |
| InChI | InChI=1S/C10H17NO3/c1-4-8-5-9(12)10(13)11(8)7(2)6-14-3/h5,7-8,12H,4,6H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | UAZMMQLJTHRKIC-JAMMHHFISA-N |
| XLogP | 1.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |