C9H10AtNO3 — CID 175700349
[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]astatine (PubChem CID 175700349) has the molecular formula C9H10AtNO3 and a molecular weight of 390.18 g/mol. Its IUPAC name is [[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]astatine.
| Compound Name | [[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]astatine |
|---|---|
| PubChem CID | 175700349 |
| Molecular Formula | C9H10AtNO3 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | [[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]astatine |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)N[At] |
| InChI | InChI=1S/C9H10AtNO3/c10-11-8(9(13)14)5-6-1-3-7(12)4-2-6/h1-4,8,11-12H,5H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | DKLLHTYSXIKUIX-QMMMGPOBSA-N |
| XLogP | 0.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |