C12H20N4O5S — CID 175700360
(2S)-1-[(2R)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 175700360) has the molecular formula C12H20N4O5S and a molecular weight of 332.38 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2R)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175700360 |
| Molecular Formula | C12H20N4O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2S)-1-[(2R)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(=O)C[C@H](N)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20N4O5S/c13-6(4-9(14)17)10(18)15-7(5-22)11(19)16-3-1-2-8(16)12(20)21/h6-8,22H,1-5,13H2,(H2,14,17)(H,15,18)(H,20,21)/t6-,7-,8-/m0/s1 |
| InChIKey | NKTLGLBAGUJEGA-FXQIFTODSA-N |
| XLogP | -2.32 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|