About 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol
3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 175700469) has the molecular formula C9H5F3N2O2
and a molecular weight of 230.15 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol |
| PubChem CID | 175700469 |
| Molecular Formula | C9H5F3N2O2 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | Oc1cccc(-c2nnc(C(F)(F)F)o2)c1 |
| InChI | InChI=1S/C9H5F3N2O2/c10-9(11,12)8-14-13-7(16-8)5-2-1-3-6(15)4-5/h1-4,15H |
| InChIKey | OMCFTBSVQYMRDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol?
The IUPAC name of 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol (CID 175700469) is 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol.
What is the SMILES notation for 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol?
The canonical SMILES for 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol is Oc1cccc(-c2nnc(C(F)(F)F)o2)c1.
What is the InChIKey of 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol?
The InChIKey is OMCFTBSVQYMRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3N2O2/c10-9(11,12)8-14-13-7(16-8)5-2-1-3-6(15)4-5/h1-4,15H.
What are the key properties of 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol?
3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol has a molecular weight of 230.15 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenol is sourced from PubChem (CID 175700469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).