About carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde
carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde (PubChem CID 175700713) has the molecular formula C13H19AuO2
and a molecular weight of 404.26 g/mol. Its IUPAC name is carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde.
Molecular Properties
| Compound Name | carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde |
| PubChem CID | 175700713 |
| Molecular Formula | C13H19AuO2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde |
| SMILES | CC(C)COc1c[c-]ccc1C=O.[Au+3].[CH3-].[CH3-] |
| InChI | InChI=1S/C11H13O2.2CH3.Au/c1-9(2)8-13-11-6-4-3-5-10(11)7-12;;;/h3,5-7,9H,8H2,1-2H3;2*1H3;/q3*-1;+3 |
| InChIKey | GCJJUKDUBBQWPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde?
The IUPAC name of carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde (CID 175700713) is carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde.
What is the SMILES notation for carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde?
The canonical SMILES for carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde is CC(C)COc1c[c-]ccc1C=O.[Au+3].[CH3-].[CH3-].
What is the InChIKey of carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde?
The InChIKey is GCJJUKDUBBQWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2.2CH3.Au/c1-9(2)8-13-11-6-4-3-5-10(11)7-12;;;/h3,5-7,9H,8H2,1-2H3;2*1H3;/q3*-1;+3.
What are the key properties of carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde?
carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde has a molecular weight of 404.26 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;gold(3+);2-(2-methylpropoxy)benzene-4-ide-1-carbaldehyde is sourced from PubChem (CID 175700713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).