About 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol
3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol (PubChem CID 175700748) has the molecular formula C31H26O6
and a molecular weight of 494.54 g/mol. Its IUPAC name is 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol.
Molecular Properties
| Compound Name | 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol |
| PubChem CID | 175700748 |
| Molecular Formula | C31H26O6 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol |
| SMILES | O=C(O)C=Cc1ccc2c(c1C=CC(=O)O)Cc1ccccc1-2.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C19H14O4.2C6H6O/c20-18(21)9-6-12-5-7-16-14-4-2-1-3-13(14)11-17(16)15(12)8-10-19(22)23;2*7-6-4-2-1-3-5-6/h1-10H,11H2,(H,20,21)(H,22,23);2*1-5,7H |
| InChIKey | FRNCAIDMDFUBCB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol?
The IUPAC name of 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol (CID 175700748) is 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol.
What is the SMILES notation for 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol?
The canonical SMILES for 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol is O=C(O)C=Cc1ccc2c(c1C=CC(=O)O)Cc1ccccc1-2.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol?
The InChIKey is FRNCAIDMDFUBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O4.2C6H6O/c20-18(21)9-6-12-5-7-16-14-4-2-1-3-13(14)11-17(16)15(12)8-10-19(22)23;2*7-6-4-2-1-3-5-6/h1-10H,11H2,(H,20,21)(H,22,23);2*1-5,7H.
What are the key properties of 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol?
3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol has a molecular weight of 494.54 g/mol, XLogP of 6.24, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-carboxyethenyl)-9H-fluoren-2-yl]prop-2-enoic acid;phenol is sourced from PubChem (CID 175700748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).