About 5-fluoro-7,8-dihydro-3H-quinazolin-4-one
5-fluoro-7,8-dihydro-3H-quinazolin-4-one (PubChem CID 175701927) has the molecular formula C8H7FN2O
and a molecular weight of 166.16 g/mol. Its IUPAC name is 5-fluoro-7,8-dihydro-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 5-fluoro-7,8-dihydro-3H-quinazolin-4-one |
| PubChem CID | 175701927 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-fluoro-7,8-dihydro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c1C(F)=CCC2 |
| InChI | InChI=1S/C8H7FN2O/c9-5-2-1-3-6-7(5)8(12)11-4-10-6/h2,4H,1,3H2,(H,10,11,12) |
| InChIKey | PZSXBMPSYFMRFU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-7,8-dihydro-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-7,8-dihydro-3H-quinazolin-4-one?
The IUPAC name of 5-fluoro-7,8-dihydro-3H-quinazolin-4-one (CID 175701927) is 5-fluoro-7,8-dihydro-3H-quinazolin-4-one.
What is the SMILES notation for 5-fluoro-7,8-dihydro-3H-quinazolin-4-one?
The canonical SMILES for 5-fluoro-7,8-dihydro-3H-quinazolin-4-one is O=c1[nH]cnc2c1C(F)=CCC2.
What is the InChIKey of 5-fluoro-7,8-dihydro-3H-quinazolin-4-one?
The InChIKey is PZSXBMPSYFMRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2O/c9-5-2-1-3-6-7(5)8(12)11-4-10-6/h2,4H,1,3H2,(H,10,11,12).
What are the key properties of 5-fluoro-7,8-dihydro-3H-quinazolin-4-one?
5-fluoro-7,8-dihydro-3H-quinazolin-4-one has a molecular weight of 166.16 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-7,8-dihydro-3H-quinazolin-4-one is sourced from PubChem (CID 175701927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).