C12H8IrN2+3 — CID 175702049
iridium(3+);1,10-phenanthroline (PubChem CID 175702049) has the molecular formula C12H8IrN2+3 and a molecular weight of 372.43 g/mol. Its IUPAC name is iridium(3+);1,10-phenanthroline.
| Compound Name | iridium(3+);1,10-phenanthroline |
|---|---|
| PubChem CID | 175702049 |
| Molecular Formula | C12H8IrN2+3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | iridium(3+);1,10-phenanthroline |
| SMILES | [Ir+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.Ir/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;/q;+3 |
| InChIKey | PFDNAHYUPNJHLV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|