C16H16ClFN4O — CID 175702346
N-[2-(6-chloro-7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine (PubChem CID 175702346) has the molecular formula C16H16ClFN4O and a molecular weight of 334.78 g/mol. Its IUPAC name is N-[2-(6-chloro-7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine.
| Compound Name | N-[2-(6-chloro-7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175702346 |
| Molecular Formula | C16H16ClFN4O |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[2-(6-chloro-7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine |
| SMILES | COc1cc(Cl)c(F)c2c1cc(C)n2CCNc1ccncn1 |
| InChI | InChI=1S/C16H16ClFN4O/c1-10-7-11-13(23-2)8-12(17)15(18)16(11)22(10)6-5-20-14-3-4-19-9-21-14/h3-4,7-9H,5-6H2,1-2H3,(H,19,20,21) |
| InChIKey | JTZTVPBYKHDOIQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |