About N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine
N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine (PubChem CID 175702369) has the molecular formula C16H16F2N4O
and a molecular weight of 318.33 g/mol. Its IUPAC name is N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine |
| PubChem CID | 175702369 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine |
| SMILES | COc1cc(F)c(F)c2c1cc(C)n2CCNc1ccncn1 |
| InChI | InChI=1S/C16H16F2N4O/c1-10-7-11-13(23-2)8-12(17)15(18)16(11)22(10)6-5-20-14-3-4-19-9-21-14/h3-4,7-9H,5-6H2,1-2H3,(H,19,20,21) |
| InChIKey | AJWOADWOYMESCT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine?
The IUPAC name of N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine (CID 175702369) is N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine.
What is the SMILES notation for N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine?
The canonical SMILES for N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine is COc1cc(F)c(F)c2c1cc(C)n2CCNc1ccncn1.
What is the InChIKey of N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine?
The InChIKey is AJWOADWOYMESCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N4O/c1-10-7-11-13(23-2)8-12(17)15(18)16(11)22(10)6-5-20-14-3-4-19-9-21-14/h3-4,7-9H,5-6H2,1-2H3,(H,19,20,21).
What are the key properties of N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine?
N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine has a molecular weight of 318.33 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6,7-difluoro-4-methoxy-2-methylindol-1-yl)ethyl]pyrimidin-4-amine is sourced from PubChem (CID 175702369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).