C23H37IO5Si — CID 175702415
(3S,4S,5E,8R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3-[(E)-1-iodoprop-1-en-2-yl]-4,8-dimethylcyclododec-5-ene-1,2,7-trione (PubChem CID 175702415) has the molecular formula C23H37IO5Si and a molecular weight of 548.53 g/mol. Its IUPAC name is (3S,4S,5E,8R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3-[(E)-1-iodoprop-1-en-2-yl]-4,8-dimethylcyclododec-5-ene-1,2,7-trione.
| Compound Name | (3S,4S,5E,8R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3-[(E)-1-iodoprop-1-en-2-yl]-4,8-dimethylcyclododec-5-ene-1,2,7-trione |
|---|---|
| PubChem CID | 175702415 |
| Molecular Formula | C23H37IO5Si |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (3S,4S,5E,8R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3-[(E)-1-iodoprop-1-en-2-yl]-4,8-dimethylcyclododec-5-ene-1,2,7-trione |
| SMILES | C/C(=C\I)[C@H]1C(=O)C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@](C)(O)C(=O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C23H37IO5Si/c1-15-9-10-19(26)23(6,28)12-11-17(29-30(7,8)22(3,4)5)13-18(25)21(27)20(15)16(2)14-24/h9-10,14-15,17,20,28H,11-13H2,1-8H3/b10-9+,16-14+/t15-,17+,20-,23+/m0/s1 |
| InChIKey | SUCBZPOOEGVBPA-JRWQUNFESA-N |
| XLogP | 5.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|