About 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate
2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 175702931) has the molecular formula C14H26N4O5
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| PubChem CID | 175702931 |
| Molecular Formula | C14H26N4O5 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCNC(=O)CNC(=O)CNC(=O)CNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C14H26N4O5/c1-5-15-10(19)6-16-11(20)7-17-12(21)8-18-13(22)23-9-14(2,3)4/h5-9H2,1-4H3,(H,15,19)(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | IKDPPBYYPZASPX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate?
The IUPAC name of 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (CID 175702931) is 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
What is the SMILES notation for 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate?
The canonical SMILES for 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate is CCNC(=O)CNC(=O)CNC(=O)CNC(=O)OCC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate?
The InChIKey is IKDPPBYYPZASPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O5/c1-5-15-10(19)6-16-11(20)7-17-12(21)8-18-13(22)23-9-14(2,3)4/h5-9H2,1-4H3,(H,15,19)(H,16,20)(H,17,21)(H,18,22).
What are the key properties of 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate?
2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate has a molecular weight of 330.39 g/mol, XLogP of -0.87, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl N-[2-[[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate is sourced from PubChem (CID 175702931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).