C22H25ClFN5O6S — CID 175702943
[(5R)-6-tert-butyl-5-[3-(5-chloro-2-nitroanilino)-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamic acid (PubChem CID 175702943) has the molecular formula C22H25ClFN5O6S and a molecular weight of 541.99 g/mol. Its IUPAC name is [(5R)-6-tert-butyl-5-[3-(5-chloro-2-nitroanilino)-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamic acid.
| Compound Name | [(5R)-6-tert-butyl-5-[3-(5-chloro-2-nitroanilino)-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175702943 |
| Molecular Formula | C22H25ClFN5O6S |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | [(5R)-6-tert-butyl-5-[3-(5-chloro-2-nitroanilino)-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamic acid |
| SMILES | CN1C(NC(=O)O)=N[C@](C)(c2cccc(Nc3cc(Cl)ccc3[N+](=O)[O-])c2F)C(C(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C22H25ClFN5O6S/c1-21(2,3)18-22(4,27-19(26-20(30)31)28(5)36(18,34)35)13-7-6-8-14(17(13)24)25-15-11-12(23)9-10-16(15)29(32)33/h6-11,18,25H,1-5H3,(H,26,27)(H,30,31)/t18?,22-/m1/s1 |
| InChIKey | RAEZEAHRHRPLDD-LMNIDFBRSA-N |
| XLogP | 4.66 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|