C32H50O2S2 — CID 175703264
2-[6-[1-oxo-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-yl]sulfanylhexylsulfanyl]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-1-one (PubChem CID 175703264) has the molecular formula C32H50O2S2 and a molecular weight of 530.88 g/mol. Its IUPAC name is 2-[6-[1-oxo-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-yl]sulfanylhexylsulfanyl]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-1-one.
| Compound Name | 2-[6-[1-oxo-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-yl]sulfanylhexylsulfanyl]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-1-one |
|---|---|
| PubChem CID | 175703264 |
| Molecular Formula | C32H50O2S2 |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 2-[6-[1-oxo-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-yl]sulfanylhexylsulfanyl]-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-1-one |
| SMILES | CCC(SCCCCCCSC(CC)C(=O)C1=C(C)C=CCC1(C)C)C(=O)C1=C(C)C=CCC1(C)C |
| InChI | InChI=1S/C32H50O2S2/c1-9-25(29(33)27-23(3)17-15-19-31(27,5)6)35-21-13-11-12-14-22-36-26(10-2)30(34)28-24(4)18-16-20-32(28,7)8/h15-18,25-26H,9-14,19-22H2,1-8H3 |
| InChIKey | UCGUDGAUEWTJCR-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|