C14H14O2 — CID 175703736
9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene-5-carbaldehyde (PubChem CID 175703736) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene-5-carbaldehyde.
| Compound Name | 9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene-5-carbaldehyde |
|---|---|
| PubChem CID | 175703736 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C1C3CCC(C3)C1O2 |
| InChI | InChI=1S/C14H14O2/c15-7-8-1-4-12-11(5-8)13-9-2-3-10(6-9)14(13)16-12/h1,4-5,7,9-10,13-14H,2-3,6H2 |
| InChIKey | PPCNMVSQUDOMHI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|