C27H32N2O2 — CID 175703916
(1S)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide (PubChem CID 175703916) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (1S)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175703916 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (1S)-2-(4-hydroxyphenyl)-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-5-yl]cyclopropane-1-carboxamide |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc(NC(=O)[C@H]2CC2c2ccc(O)cc2)ccc13 |
| InChI | InChI=1S/C27H32N2O2/c1-29-13-12-27-11-3-2-4-24(27)25(29)15-18-14-19(7-10-23(18)27)28-26(31)22-16-21(22)17-5-8-20(30)9-6-17/h5-10,14,21-22,24-25,30H,2-4,11-13,15-16H2,1H3,(H,28,31)/t21?,22-,24-,25+,27-/m0/s1 |
| InChIKey | WLQSUQSBTQOJLE-JJKPGVEHSA-N |
| XLogP | 4.82 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |