C37H42Hf — CID 175704713
cyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylpent-4-enylidenehafnium(2+) (PubChem CID 175704713) has the molecular formula C37H42Hf and a molecular weight of 665.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylpent-4-enylidenehafnium(2+).
| Compound Name | cyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylpent-4-enylidenehafnium(2+) |
|---|---|
| PubChem CID | 175704713 |
| Molecular Formula | C37H42Hf |
| Molecular Weight | 665.23 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | cyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylpent-4-enylidenehafnium(2+) |
| SMILES | C=CCCC(=[Hf+2])c1ccccc1.CC(C)(C)c1[c-]c2c(cc1)-c1ccc(C(C)(C)C)cc1C2.c1cc[cH-]c1 |
| InChI | InChI=1S/C21H25.C11H12.C5H5.Hf/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-2-3-5-8-11-9-6-4-7-10-11;1-2-4-5-3-1;/h7-10,12H,11H2,1-6H3;2,4,6-7,9-10H,1,3,5H2;1-5H;/q-1;;-1;+2 |
| InChIKey | GIDODWXOBKYSHT-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.23 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|