C17H17F6NO2 — CID 175704864
4-(trifluoromethoxy)-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide (PubChem CID 175704864) has the molecular formula C17H17F6NO2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide.
| Compound Name | 4-(trifluoromethoxy)-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide |
|---|---|
| PubChem CID | 175704864 |
| Molecular Formula | C17H17F6NO2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-(trifluoromethoxy)-N-[4-(trifluoromethyl)-1-bicyclo[2.2.2]octanyl]benzamide |
| SMILES | O=C(NC12CCC(C(F)(F)F)(CC1)CC2)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F6NO2/c18-16(19,20)14-5-8-15(9-6-14,10-7-14)24-13(25)11-1-3-12(4-2-11)26-17(21,22)23/h1-4H,5-10H2,(H,24,25) |
| InChIKey | LIXVMHYICLLLCB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |