About 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole
5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole (PubChem CID 175705455) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole.
Molecular Properties
| Compound Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole |
| PubChem CID | 175705455 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole |
| SMILES | Cn1nnc(C2C=CC=CC2Cl)n1 |
| InChI | InChI=1S/C8H9ClN4/c1-13-11-8(10-12-13)6-4-2-3-5-7(6)9/h2-7H,1H3 |
| InChIKey | XMLBSSAIKAWHGO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole?
The IUPAC name of 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole (CID 175705455) is 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole.
What is the SMILES notation for 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole?
The canonical SMILES for 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole is Cn1nnc(C2C=CC=CC2Cl)n1.
What is the InChIKey of 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole?
The InChIKey is XMLBSSAIKAWHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4/c1-13-11-8(10-12-13)6-4-2-3-5-7(6)9/h2-7H,1H3.
What are the key properties of 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole?
5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole has a molecular weight of 196.64 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2-methyltetrazole is sourced from PubChem (CID 175705455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).