About (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole
(3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 175705639) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole.
Analyze (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole?
The IUPAC name of (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole (CID 175705639) is (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole.
What is the SMILES notation for (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole?
The canonical SMILES for (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole is C1=C2NCC[C@H]2CN1.
What is the InChIKey of (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole?
The InChIKey is FTUSZJTUFHXUPG-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10N2/c1-2-8-6-4-7-3-5(1)6/h4-5,7-8H,1-3H2/t5-/m0/s1.
What are the key properties of (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole?
(3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole has a molecular weight of 110.16 g/mol, XLogP of 0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole is sourced from PubChem (CID 175705639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).