C14H24N4O5S — CID 175705752
[(2S,5R)-2-(N'-cycloheptylcarbamimidoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175705752) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is [(2S,5R)-2-(N'-cycloheptylcarbamimidoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-(N'-cycloheptylcarbamimidoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175705752 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(2S,5R)-2-(N'-cycloheptylcarbamimidoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C1CCCCCC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H24N4O5S/c15-13(16-10-5-3-1-2-4-6-10)12-8-7-11-9-17(12)14(19)18(11)23-24(20,21)22/h10-12H,1-9H2,(H2,15,16)(H,20,21,22)/t11-,12+/m1/s1 |
| InChIKey | TYQBGPJKPACVOV-NEPJUHHUSA-N |
| XLogP | 1.07 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|