About [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate
[3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate (PubChem CID 175706680) has the molecular formula C24H26ClN3O5
and a molecular weight of 471.94 g/mol. Its IUPAC name is [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate |
| PubChem CID | 175706680 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate |
| SMILES | CNC(=O)OC1CC(Oc2cc(-c3ccc(O)cc3Cl)cc3c2cnn3C2CCCCO2)C1 |
| InChI | InChI=1S/C24H26ClN3O5/c1-26-24(30)33-17-11-16(12-17)32-22-9-14(18-6-5-15(29)10-20(18)25)8-21-19(22)13-27-28(21)23-4-2-3-7-31-23/h5-6,8-10,13,16-17,23,29H,2-4,7,11-12H2,1H3,(H,26,30) |
| InChIKey | QILJTDPGYREXPS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate?
The IUPAC name of [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate (CID 175706680) is [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate.
What is the SMILES notation for [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate?
The canonical SMILES for [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate is CNC(=O)OC1CC(Oc2cc(-c3ccc(O)cc3Cl)cc3c2cnn3C2CCCCO2)C1.
What is the InChIKey of [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate?
The InChIKey is QILJTDPGYREXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClN3O5/c1-26-24(30)33-17-11-16(12-17)32-22-9-14(18-6-5-15(29)10-20(18)25)8-21-19(22)13-27-28(21)23-4-2-3-7-31-23/h5-6,8-10,13,16-17,23,29H,2-4,7,11-12H2,1H3,(H,26,30).
What are the key properties of [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate?
[3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate has a molecular weight of 471.94 g/mol, XLogP of 5.03, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[6-(2-chloro-4-hydroxyphenyl)-1-(oxan-2-yl)indazol-4-yl]oxycyclobutyl] N-methylcarbamate is sourced from PubChem (CID 175706680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).