C5H12N2O4S — CID 175706695
4-N,4-N,4-N',4-N'-tetramethyl-2,2-dioxo-1,3,2-dioxathietane-4,4-diamine (PubChem CID 175706695) has the molecular formula C5H12N2O4S and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-N,4-N,4-N',4-N'-tetramethyl-2,2-dioxo-1,3,2-dioxathietane-4,4-diamine.
| Compound Name | 4-N,4-N,4-N',4-N'-tetramethyl-2,2-dioxo-1,3,2-dioxathietane-4,4-diamine |
|---|---|
| PubChem CID | 175706695 |
| Molecular Formula | C5H12N2O4S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-N,4-N,4-N',4-N'-tetramethyl-2,2-dioxo-1,3,2-dioxathietane-4,4-diamine |
| SMILES | CN(C)C1(N(C)C)OS(=O)(=O)O1 |
| InChI | InChI=1S/C5H12N2O4S/c1-6(2)5(7(3)4)10-12(8,9)11-5/h1-4H3 |
| InChIKey | CLHKNHLPXWSNTQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|