C26H34N6O6S — CID 175707125
(2R)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 175707125) has the molecular formula C26H34N6O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is (2R)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175707125 |
| Molecular Formula | C26H34N6O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (2R)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C26H34N6O6S/c27-25(28)29-13-7-12-19(22(33)31-21(16-39)24(35)36)30-23(34)20(14-17-8-3-1-4-9-17)32-26(37)38-15-18-10-5-2-6-11-18/h1-6,8-11,19-21,39H,7,12-16H2,(H,30,34)(H,31,33)(H,32,37)(H,35,36)(H4,27,28,29)/t19-,20+,21-/m0/s1 |
| InChIKey | JVBATXAKGGGXNT-HBMCJLEFSA-N |
| XLogP | 0.56 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|