C20H26F3IO3S — CID 175707907
5-(2-tert-butylphenyl)-6-iodo-1,3,5-trimethylcyclohexa-1,3-diene;trifluoromethanesulfonic acid (PubChem CID 175707907) has the molecular formula C20H26F3IO3S and a molecular weight of 530.39 g/mol. Its IUPAC name is 5-(2-tert-butylphenyl)-6-iodo-1,3,5-trimethylcyclohexa-1,3-diene;trifluoromethanesulfonic acid.
| Compound Name | 5-(2-tert-butylphenyl)-6-iodo-1,3,5-trimethylcyclohexa-1,3-diene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175707907 |
| Molecular Formula | C20H26F3IO3S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 5-(2-tert-butylphenyl)-6-iodo-1,3,5-trimethylcyclohexa-1,3-diene;trifluoromethanesulfonic acid |
| SMILES | CC1=CC(C)(c2ccccc2C(C)(C)C)C(I)C(C)=C1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C19H25I.CHF3O3S/c1-13-11-14(2)17(20)19(6,12-13)16-10-8-7-9-15(16)18(3,4)5;2-1(3,4)8(5,6)7/h7-12,17H,1-6H3;(H,5,6,7) |
| InChIKey | MHENJSNSLSIART-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|