C21H30N4O4 — CID 175708028
4-[[2-[(2S,5S)-2-cyclohexyl-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide (PubChem CID 175708028) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-[[2-[(2S,5S)-2-cyclohexyl-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide.
| Compound Name | 4-[[2-[(2S,5S)-2-cyclohexyl-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 175708028 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-[[2-[(2S,5S)-2-cyclohexyl-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1nccc(NC(=O)C(=O)N2C[C@@H](C)CC[C@H]2C2CCCCC2)c1C(N)=O |
| InChI | InChI=1S/C21H30N4O4/c1-13-8-9-16(14-6-4-3-5-7-14)25(12-13)21(28)19(27)24-15-10-11-23-20(29-2)17(15)18(22)26/h10-11,13-14,16H,3-9,12H2,1-2H3,(H2,22,26)(H,23,24,27)/t13-,16-/m0/s1 |
| InChIKey | HTNSHCIIFXISHV-BBRMVZONSA-N |
| XLogP | 2.34 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|